C26H36FN3O3 — CID 58653426
N-[3-fluoro-4-[(5R)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]phenyl]cyclopentanecarboxamide (PubChem CID 58653426) has the molecular formula C26H36FN3O3 and a molecular weight of 457.59 g/mol. Its IUPAC name is N-[3-fluoro-4-[(5R)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-fluoro-4-[(5R)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 58653426 |
| Molecular Formula | C26H36FN3O3 |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | N-[3-fluoro-4-[(5R)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]phenyl]cyclopentanecarboxamide |
| SMILES | O=C(Nc1ccc(N2CCC[C@@]3(CCN(C4CCC(O)CC4)C3=O)C2)c(F)c1)C1CCCC1 |
| InChI | InChI=1S/C26H36FN3O3/c27-22-16-19(28-24(32)18-4-1-2-5-18)6-11-23(22)29-14-3-12-26(17-29)13-15-30(25(26)33)20-7-9-21(31)10-8-20/h6,11,16,18,20-21,31H,1-5,7-10,12-15,17H2,(H,28,32)/t20?,21?,26-/m1/s1 |
| InChIKey | VAMLZHDXQHTCHM-VGMBQNGWSA-N |
| XLogP | 4.08 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|