C26H34FN3O3 — CID 153013389
N-[3-fluoro-4-[(5R)-2-(4-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]phenyl]propanamide (PubChem CID 153013389) has the molecular formula C26H34FN3O3 and a molecular weight of 455.57 g/mol. Its IUPAC name is N-[3-fluoro-4-[(5R)-2-(4-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]phenyl]propanamide.
| Compound Name | N-[3-fluoro-4-[(5R)-2-(4-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 153013389 |
| Molecular Formula | C26H34FN3O3 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | N-[3-fluoro-4-[(5R)-2-(4-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(N2CCC[C@@]3(CCN(C45CC6CC(C4)C(C5)C6O)C3=O)C2)c(F)c1 |
| InChI | InChI=1S/C26H34FN3O3/c1-2-22(31)28-18-4-5-21(20(27)11-18)29-8-3-6-25(15-29)7-9-30(24(25)33)26-12-16-10-17(13-26)23(32)19(16)14-26/h4-5,11,16-17,19,23,32H,2-3,6-10,12-15H2,1H3,(H,28,31)/t16?,17?,19?,23?,25-,26?/m1/s1 |
| InChIKey | VAMNJXBRGJYGTJ-MWWRVVOVSA-N |
| XLogP | 3.54 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|