C24H35N3O4 — CID 58653320
methyl N-[4-[(5R)-2-(4-hydroxy-4-methylcyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-3-methylphenyl]carbamate (PubChem CID 58653320) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is methyl N-[4-[(5R)-2-(4-hydroxy-4-methylcyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-3-methylphenyl]carbamate.
| Compound Name | methyl N-[4-[(5R)-2-(4-hydroxy-4-methylcyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-3-methylphenyl]carbamate |
|---|---|
| PubChem CID | 58653320 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | methyl N-[4-[(5R)-2-(4-hydroxy-4-methylcyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-3-methylphenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(N2CCC[C@@]3(CCN(C4CCC(C)(O)CC4)C3=O)C2)c(C)c1 |
| InChI | InChI=1S/C24H35N3O4/c1-17-15-18(25-22(29)31-3)5-6-20(17)26-13-4-9-24(16-26)12-14-27(21(24)28)19-7-10-23(2,30)11-8-19/h5-6,15,19,30H,4,7-14,16H2,1-3H3,(H,25,29)/t19?,23?,24-/m1/s1 |
| InChIKey | MDQUKGXLOMDIIN-PBSMCPNCSA-N |
| XLogP | 3.69 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|