C24H32F3N3O3 — CID 76677805
methyl N-[4-(2-cyclohexyl-1-oxo-2,9-diazaspiro[4.5]decan-9-yl)-3-(trifluoromethyl)phenyl]-N-methylcarbamate (PubChem CID 76677805) has the molecular formula C24H32F3N3O3 and a molecular weight of 467.53 g/mol. Its IUPAC name is methyl N-[4-(2-cyclohexyl-1-oxo-2,9-diazaspiro[4.5]decan-9-yl)-3-(trifluoromethyl)phenyl]-N-methylcarbamate.
| Compound Name | methyl N-[4-(2-cyclohexyl-1-oxo-2,9-diazaspiro[4.5]decan-9-yl)-3-(trifluoromethyl)phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 76677805 |
| Molecular Formula | C24H32F3N3O3 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | methyl N-[4-(2-cyclohexyl-1-oxo-2,9-diazaspiro[4.5]decan-9-yl)-3-(trifluoromethyl)phenyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)c1ccc(N2CCCC3(CCN(C4CCCCC4)C3=O)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H32F3N3O3/c1-28(22(32)33-2)18-9-10-20(19(15-18)24(25,26)27)29-13-6-11-23(16-29)12-14-30(21(23)31)17-7-4-3-5-8-17/h9-10,15,17H,3-8,11-14,16H2,1-2H3 |
| InChIKey | YKKQHBXGHVHGFF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|