C23H33N3O4 — CID 66722332
[4-[(5S)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-2-methylphenyl]-methylcarbamic acid (PubChem CID 66722332) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is [4-[(5S)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-2-methylphenyl]-methylcarbamic acid.
| Compound Name | [4-[(5S)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-2-methylphenyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 66722332 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | [4-[(5S)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-2-methylphenyl]-methylcarbamic acid |
| SMILES | Cc1cc(N2CCC[C@]3(CCN(C4CCC(O)CC4)C3=O)C2)ccc1N(C)C(=O)O |
| InChI | InChI=1S/C23H33N3O4/c1-16-14-18(6-9-20(16)24(2)22(29)30)25-12-3-10-23(15-25)11-13-26(21(23)28)17-4-7-19(27)8-5-17/h6,9,14,17,19,27H,3-5,7-8,10-13,15H2,1-2H3,(H,29,30)/t17?,19?,23-/m0/s1 |
| InChIKey | KCYNRRSJVSDYCV-WFHLNLCJSA-N |
| XLogP | 3.23 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|