C25H33N3O4 — CID 87124882
[4-[(5S)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-2-methylphenyl]-prop-2-ynylcarbamic acid (PubChem CID 87124882) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is [4-[(5S)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-2-methylphenyl]-prop-2-ynylcarbamic acid.
| Compound Name | [4-[(5S)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-2-methylphenyl]-prop-2-ynylcarbamic acid |
|---|---|
| PubChem CID | 87124882 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | [4-[(5S)-2-(4-hydroxycyclohexyl)-1-oxo-2,9-diazaspiro[4.5]decan-9-yl]-2-methylphenyl]-prop-2-ynylcarbamic acid |
| SMILES | C#CCN(C(=O)O)c1ccc(N2CCC[C@]3(CCN(C4CCC(O)CC4)C3=O)C2)cc1C |
| InChI | InChI=1S/C25H33N3O4/c1-3-13-28(24(31)32)22-10-7-20(16-18(22)2)26-14-4-11-25(17-26)12-15-27(23(25)30)19-5-8-21(29)9-6-19/h1,7,10,16,19,21,29H,4-6,8-9,11-15,17H2,2H3,(H,31,32)/t19?,21?,25-/m0/s1 |
| InChIKey | UKFCIZAPGPNWOG-AJPKXHFHSA-N |
| XLogP | 3.24 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|