C22H28ClN3O2 — CID 173174898
(5R)-9-(3-chloro-6-prop-2-ynyl-2-pyridinyl)-2-(4-hydroxycyclohexyl)-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 173174898) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is (5R)-9-(3-chloro-6-prop-2-ynyl-2-pyridinyl)-2-(4-hydroxycyclohexyl)-2,9-diazaspiro[4.5]decan-1-one.
| Compound Name | (5R)-9-(3-chloro-6-prop-2-ynyl-2-pyridinyl)-2-(4-hydroxycyclohexyl)-2,9-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 173174898 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | (5R)-9-(3-chloro-6-prop-2-ynyl-2-pyridinyl)-2-(4-hydroxycyclohexyl)-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | C#CCc1ccc(Cl)c(N2CCC[C@@]3(CCN(C4CCC(O)CC4)C3=O)C2)n1 |
| InChI | InChI=1S/C22H28ClN3O2/c1-2-4-16-5-10-19(23)20(24-16)25-13-3-11-22(15-25)12-14-26(21(22)28)17-6-8-18(27)9-7-17/h1,5,10,17-18,27H,3-4,6-9,11-15H2/t17?,18?,22-/m1/s1 |
| InChIKey | IIWWCKYXODQCDY-RWWKDMOOSA-N |
| XLogP | 3.03 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|