C17H15ClF3N2O2P — CID 143230571
(Z)-3-(2-amino-5-chlorophenyl)-3-[methoxy-[3-(trifluoromethyl)phenyl]phosphanyl]prop-2-enamide (PubChem CID 143230571) has the molecular formula C17H15ClF3N2O2P and a molecular weight of 402.74 g/mol. Its IUPAC name is (Z)-3-(2-amino-5-chlorophenyl)-3-[methoxy-[3-(trifluoromethyl)phenyl]phosphanyl]prop-2-enamide.
| Compound Name | (Z)-3-(2-amino-5-chlorophenyl)-3-[methoxy-[3-(trifluoromethyl)phenyl]phosphanyl]prop-2-enamide |
|---|---|
| PubChem CID | 143230571 |
| Molecular Formula | C17H15ClF3N2O2P |
| Molecular Weight | 402.74 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | (Z)-3-(2-amino-5-chlorophenyl)-3-[methoxy-[3-(trifluoromethyl)phenyl]phosphanyl]prop-2-enamide |
| SMILES | COP(/C(=C\C(N)=O)c1cc(Cl)ccc1N)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15ClF3N2O2P/c1-25-26(12-4-2-3-10(7-12)17(19,20)21)15(9-16(23)24)13-8-11(18)5-6-14(13)22/h2-9H,22H2,1H3,(H2,23,24)/b15-9- |
| InChIKey | SJLFHSDSZVRZCQ-DHDCSXOGSA-N |
| XLogP | 4.14 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.74 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|