About ethane;fluoro 2-[(4-chlorophenyl)methylideneamino]-3-(4-methylphenyl)propanoate
ethane;fluoro 2-[(4-chlorophenyl)methylideneamino]-3-(4-methylphenyl)propanoate (PubChem CID 143230724) has the molecular formula C19H21ClFNO2
and a molecular weight of 349.83 g/mol. Its IUPAC name is ethane;fluoro 2-[(4-chlorophenyl)methylideneamino]-3-(4-methylphenyl)propanoate.
Molecular Properties
| Compound Name | ethane;fluoro 2-[(4-chlorophenyl)methylideneamino]-3-(4-methylphenyl)propanoate |
| PubChem CID | 143230724 |
| Molecular Formula | C19H21ClFNO2 |
| Molecular Weight | 349.83 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | ethane;fluoro 2-[(4-chlorophenyl)methylideneamino]-3-(4-methylphenyl)propanoate |
| SMILES | CC.Cc1ccc(CC(/N=C/c2ccc(Cl)cc2)C(=O)OF)cc1 |
| InChI | InChI=1S/C17H15ClFNO2.C2H6/c1-12-2-4-13(5-3-12)10-16(17(21)22-19)20-11-14-6-8-15(18)9-7-14;1-2/h2-9,11,16H,10H2,1H3;1-2H3/b20-11+; |
| InChIKey | FDQOQRFFRGAOAV-DOELHFPHSA-N |
| XLogP | 5.13 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.83 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;fluoro 2-[(4-chlorophenyl)methylideneamino]-3-(4-methylphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;fluoro 2-[(4-chlorophenyl)methylideneamino]-3-(4-methylphenyl)propanoate?
The IUPAC name of ethane;fluoro 2-[(4-chlorophenyl)methylideneamino]-3-(4-methylphenyl)propanoate (CID 143230724) is ethane;fluoro 2-[(4-chlorophenyl)methylideneamino]-3-(4-methylphenyl)propanoate.
What is the SMILES notation for ethane;fluoro 2-[(4-chlorophenyl)methylideneamino]-3-(4-methylphenyl)propanoate?
The canonical SMILES for ethane;fluoro 2-[(4-chlorophenyl)methylideneamino]-3-(4-methylphenyl)propanoate is CC.Cc1ccc(CC(/N=C/c2ccc(Cl)cc2)C(=O)OF)cc1.
What is the InChIKey of ethane;fluoro 2-[(4-chlorophenyl)methylideneamino]-3-(4-methylphenyl)propanoate?
The InChIKey is FDQOQRFFRGAOAV-DOELHFPHSA-N. The full InChI is InChI=1S/C17H15ClFNO2.C2H6/c1-12-2-4-13(5-3-12)10-16(17(21)22-19)20-11-14-6-8-15(18)9-7-14;1-2/h2-9,11,16H,10H2,1H3;1-2H3/b20-11+;.
What are the key properties of ethane;fluoro 2-[(4-chlorophenyl)methylideneamino]-3-(4-methylphenyl)propanoate?
ethane;fluoro 2-[(4-chlorophenyl)methylideneamino]-3-(4-methylphenyl)propanoate has a molecular weight of 349.83 g/mol, XLogP of 5.13, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;fluoro 2-[(4-chlorophenyl)methylideneamino]-3-(4-methylphenyl)propanoate is sourced from PubChem (CID 143230724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).