C11H30N2O — CID 143231168
N',2-dimethylpentane-1,5-diamine;methanol;propane (PubChem CID 143231168) has the molecular formula C11H30N2O and a molecular weight of 206.37 g/mol. Its IUPAC name is N',2-dimethylpentane-1,5-diamine;methanol;propane.
| Compound Name | N',2-dimethylpentane-1,5-diamine;methanol;propane |
|---|---|
| PubChem CID | 143231168 |
| Molecular Formula | C11H30N2O |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.24 |
| IUPAC Name | N',2-dimethylpentane-1,5-diamine;methanol;propane |
| SMILES | CCC.CNCCCC(C)CN.CO |
| InChI | InChI=1S/C7H18N2.C3H8.CH4O/c1-7(6-8)4-3-5-9-2;1-3-2;1-2/h7,9H,3-6,8H2,1-2H3;3H2,1-2H3;2H,1H3 |
| InChIKey | GXHLMVVLVAVFAL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|