C15H22FNO — CID 143232924
1-[(4Z,6E)-6-fluoronona-4,6,8-trienyl]azepan-2-one (PubChem CID 143232924) has the molecular formula C15H22FNO and a molecular weight of 251.34 g/mol. Its IUPAC name is 1-[(4Z,6E)-6-fluoronona-4,6,8-trienyl]azepan-2-one.
| Compound Name | 1-[(4Z,6E)-6-fluoronona-4,6,8-trienyl]azepan-2-one |
|---|---|
| PubChem CID | 143232924 |
| Molecular Formula | C15H22FNO |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 1-[(4Z,6E)-6-fluoronona-4,6,8-trienyl]azepan-2-one |
| SMILES | C=C/C=C(F)\C=C/CCCN1CCCCCC1=O |
| InChI | InChI=1S/C15H22FNO/c1-2-9-14(16)10-5-3-7-12-17-13-8-4-6-11-15(17)18/h2,5,9-10H,1,3-4,6-8,11-13H2/b10-5-,14-9+ |
| InChIKey | GGAMZYIYSBQCSA-UJMFUDEJSA-N |
| XLogP | 3.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|