C9H13N3 — CID 143232966
6,6-dimethyl-1,7-dihydroindazol-3-amine (PubChem CID 143232966) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 6,6-dimethyl-1,7-dihydroindazol-3-amine.
| Compound Name | 6,6-dimethyl-1,7-dihydroindazol-3-amine |
|---|---|
| PubChem CID | 143232966 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 6,6-dimethyl-1,7-dihydroindazol-3-amine |
| SMILES | CC1(C)C=Cc2c(N)n[nH]c2C1 |
| InChI | InChI=1S/C9H13N3/c1-9(2)4-3-6-7(5-9)11-12-8(6)10/h3-4H,5H2,1-2H3,(H3,10,11,12) |
| InChIKey | GMXQKFVOKSGZMW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |