C10H11F3N2 — CID 154405657
6,6-dimethyl-3-(trifluoromethyl)-1,7-dihydroindazole (PubChem CID 154405657) has the molecular formula C10H11F3N2 and a molecular weight of 216.21 g/mol. Its IUPAC name is 6,6-dimethyl-3-(trifluoromethyl)-1,7-dihydroindazole.
| Compound Name | 6,6-dimethyl-3-(trifluoromethyl)-1,7-dihydroindazole |
|---|---|
| PubChem CID | 154405657 |
| Molecular Formula | C10H11F3N2 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 6,6-dimethyl-3-(trifluoromethyl)-1,7-dihydroindazole |
| SMILES | CC1(C)C=Cc2c(C(F)(F)F)n[nH]c2C1 |
| InChI | InChI=1S/C10H11F3N2/c1-9(2)4-3-6-7(5-9)14-15-8(6)10(11,12)13/h3-4H,5H2,1-2H3,(H,14,15) |
| InChIKey | LLOABOLWWOQXOH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |