C29H35FN4O4 — CID 143233176
1-(4-fluorophenyl)-5-[(3R,5R)-5-hydroxy-3-methyl-7-(1-oxidoaziridin-1-ium-1-yl)-7-oxoheptyl]-N-phenyl-4-propan-2-ylpyrazole-3-carboxamide (PubChem CID 143233176) has the molecular formula C29H35FN4O4 and a molecular weight of 522.62 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-[(3R,5R)-5-hydroxy-3-methyl-7-(1-oxidoaziridin-1-ium-1-yl)-7-oxoheptyl]-N-phenyl-4-propan-2-ylpyrazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-5-[(3R,5R)-5-hydroxy-3-methyl-7-(1-oxidoaziridin-1-ium-1-yl)-7-oxoheptyl]-N-phenyl-4-propan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 143233176 |
| Molecular Formula | C29H35FN4O4 |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 1-(4-fluorophenyl)-5-[(3R,5R)-5-hydroxy-3-methyl-7-(1-oxidoaziridin-1-ium-1-yl)-7-oxoheptyl]-N-phenyl-4-propan-2-ylpyrazole-3-carboxamide |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)nn(-c2ccc(F)cc2)c1CC[C@@H](C)C[C@@H](O)CC(=O)[N+]1([O-])CC1 |
| InChI | InChI=1S/C29H35FN4O4/c1-19(2)27-25(14-9-20(3)17-24(35)18-26(36)34(38)15-16-34)33(23-12-10-21(30)11-13-23)32-28(27)29(37)31-22-7-5-4-6-8-22/h4-8,10-13,19-20,24,35H,9,14-18H2,1-3H3,(H,31,37)/t20-,24-/m1/s1 |
| InChIKey | FWDXFJBAHYMAJT-HYBUGGRVSA-N |
| XLogP | 4.95 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|