C24H33FN3O5- — CID 59832075
(3R,5R)-7-[5-(butylcarbamoyl)-2-(4-fluorophenyl)-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate (PubChem CID 59832075) has the molecular formula C24H33FN3O5- and a molecular weight of 462.54 g/mol. Its IUPAC name is (3R,5R)-7-[5-(butylcarbamoyl)-2-(4-fluorophenyl)-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate.
| Compound Name | (3R,5R)-7-[5-(butylcarbamoyl)-2-(4-fluorophenyl)-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate |
|---|---|
| PubChem CID | 59832075 |
| Molecular Formula | C24H33FN3O5- |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | (3R,5R)-7-[5-(butylcarbamoyl)-2-(4-fluorophenyl)-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate |
| SMILES | CCCCNC(=O)c1nn(-c2ccc(F)cc2)c(CC[C@@H](O)C[C@@H](O)CC(=O)[O-])c1C(C)C |
| InChI | InChI=1S/C24H34FN3O5/c1-4-5-12-26-24(33)23-22(15(2)3)20(11-10-18(29)13-19(30)14-21(31)32)28(27-23)17-8-6-16(25)7-9-17/h6-9,15,18-19,29-30H,4-5,10-14H2,1-3H3,(H,26,33)(H,31,32)/p-1/t18-,19-/m1/s1 |
| InChIKey | MGXHFMLOYFXZFB-RTBURBONSA-M |
| XLogP | 1.85 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|