C28H30FN4O5- — CID 59831938
(3R,5R)-7-[2-(4-fluorophenyl)-5-[(3-isocyanophenyl)methylcarbamoyl]-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate (PubChem CID 59831938) has the molecular formula C28H30FN4O5- and a molecular weight of 521.57 g/mol. Its IUPAC name is (3R,5R)-7-[2-(4-fluorophenyl)-5-[(3-isocyanophenyl)methylcarbamoyl]-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate.
| Compound Name | (3R,5R)-7-[2-(4-fluorophenyl)-5-[(3-isocyanophenyl)methylcarbamoyl]-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate |
|---|---|
| PubChem CID | 59831938 |
| Molecular Formula | C28H30FN4O5- |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | (3R,5R)-7-[2-(4-fluorophenyl)-5-[(3-isocyanophenyl)methylcarbamoyl]-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate |
| SMILES | [C-]#[N+]c1cccc(CNC(=O)c2nn(-c3ccc(F)cc3)c(CC[C@@H](O)C[C@@H](O)CC(=O)[O-])c2C(C)C)c1 |
| InChI | InChI=1S/C28H31FN4O5/c1-17(2)26-24(12-11-22(34)14-23(35)15-25(36)37)33(21-9-7-19(29)8-10-21)32-27(26)28(38)31-16-18-5-4-6-20(13-18)30-3/h4-10,13,17,22-23,34-35H,11-12,14-16H2,1-2H3,(H,31,38)(H,36,37)/p-1/t22-,23-/m1/s1 |
| InChIKey | PNXYLUFPWXXEOR-DHIUTWEWSA-M |
| XLogP | 2.80 |
| TPSA | 131.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|