About 2-[3-(2,3-dimethylbutan-2-yl)phenyl]propan-2-ylcarbamic acid;4-methylpentan-2-ol;2-methylpropane
2-[3-(2,3-dimethylbutan-2-yl)phenyl]propan-2-ylcarbamic acid;4-methylpentan-2-ol;2-methylpropane (PubChem CID 143233847) has the molecular formula C26H49NO3
and a molecular weight of 423.68 g/mol. Its IUPAC name is 2-[3-(2,3-dimethylbutan-2-yl)phenyl]propan-2-ylcarbamic acid;4-methylpentan-2-ol;2-methylpropane.
Molecular Properties
| Compound Name | 2-[3-(2,3-dimethylbutan-2-yl)phenyl]propan-2-ylcarbamic acid;4-methylpentan-2-ol;2-methylpropane |
| PubChem CID | 143233847 |
| Molecular Formula | C26H49NO3 |
| Molecular Weight | 423.68 g/mol |
| Exact Mass | 423.37 |
| IUPAC Name | 2-[3-(2,3-dimethylbutan-2-yl)phenyl]propan-2-ylcarbamic acid;4-methylpentan-2-ol;2-methylpropane |
| SMILES | CC(C)C.CC(C)C(C)(C)c1cccc(C(C)(C)NC(=O)O)c1.CC(C)CC(C)O |
| InChI | InChI=1S/C16H25NO2.C6H14O.C4H10/c1-11(2)15(3,4)12-8-7-9-13(10-12)16(5,6)17-14(18)19;1-5(2)4-6(3)7;1-4(2)3/h7-11,17H,1-6H3,(H,18,19);5-7H,4H2,1-3H3;4H,1-3H3 |
| InChIKey | YLDNCURDKPPVRI-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.68 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3-(2,3-dimethylbutan-2-yl)phenyl]propan-2-ylcarbamic acid;4-methylpentan-2-ol;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,3-dimethylbutan-2-yl)phenyl]propan-2-ylcarbamic acid;4-methylpentan-2-ol;2-methylpropane?
The IUPAC name of 2-[3-(2,3-dimethylbutan-2-yl)phenyl]propan-2-ylcarbamic acid;4-methylpentan-2-ol;2-methylpropane (CID 143233847) is 2-[3-(2,3-dimethylbutan-2-yl)phenyl]propan-2-ylcarbamic acid;4-methylpentan-2-ol;2-methylpropane.
What is the SMILES notation for 2-[3-(2,3-dimethylbutan-2-yl)phenyl]propan-2-ylcarbamic acid;4-methylpentan-2-ol;2-methylpropane?
The canonical SMILES for 2-[3-(2,3-dimethylbutan-2-yl)phenyl]propan-2-ylcarbamic acid;4-methylpentan-2-ol;2-methylpropane is CC(C)C.CC(C)C(C)(C)c1cccc(C(C)(C)NC(=O)O)c1.CC(C)CC(C)O.
What is the InChIKey of 2-[3-(2,3-dimethylbutan-2-yl)phenyl]propan-2-ylcarbamic acid;4-methylpentan-2-ol;2-methylpropane?
The InChIKey is YLDNCURDKPPVRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2.C6H14O.C4H10/c1-11(2)15(3,4)12-8-7-9-13(10-12)16(5,6)17-14(18)19;1-5(2)4-6(3)7;1-4(2)3/h7-11,17H,1-6H3,(H,18,19);5-7H,4H2,1-3H3;4H,1-3H3.
What are the key properties of 2-[3-(2,3-dimethylbutan-2-yl)phenyl]propan-2-ylcarbamic acid;4-methylpentan-2-ol;2-methylpropane?
2-[3-(2,3-dimethylbutan-2-yl)phenyl]propan-2-ylcarbamic acid;4-methylpentan-2-ol;2-methylpropane has a molecular weight of 423.68 g/mol, XLogP of 7.20, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,3-dimethylbutan-2-yl)phenyl]propan-2-ylcarbamic acid;4-methylpentan-2-ol;2-methylpropane is sourced from PubChem (CID 143233847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).