C16H25N3O4 — CID 172570692
2-[3-[2-[amino(ethoxycarbonyl)amino]propan-2-yl]phenyl]propan-2-ylcarbamic acid (PubChem CID 172570692) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-[3-[2-[amino(ethoxycarbonyl)amino]propan-2-yl]phenyl]propan-2-ylcarbamic acid.
| Compound Name | 2-[3-[2-[amino(ethoxycarbonyl)amino]propan-2-yl]phenyl]propan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 172570692 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 2-[3-[2-[amino(ethoxycarbonyl)amino]propan-2-yl]phenyl]propan-2-ylcarbamic acid |
| SMILES | CCOC(=O)N(N)C(C)(C)c1cccc(C(C)(C)NC(=O)O)c1 |
| InChI | InChI=1S/C16H25N3O4/c1-6-23-14(22)19(17)16(4,5)12-9-7-8-11(10-12)15(2,3)18-13(20)21/h7-10,18H,6,17H2,1-5H3,(H,20,21) |
| InChIKey | VJTRQNAUWNDQER-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|