C15H20N2O6 — CID 134841276
(2R)-2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-phenylpropanoic acid (PubChem CID 134841276) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is (2R)-2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-phenylpropanoic acid.
| Compound Name | (2R)-2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 134841276 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (2R)-2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-phenylpropanoic acid |
| SMILES | CCOC(=O)NN(C(=O)OCC)[C@@](C)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O6/c1-4-22-13(20)16-17(14(21)23-5-2)15(3,12(18)19)11-9-7-6-8-10-11/h6-10H,4-5H2,1-3H3,(H,16,20)(H,18,19)/t15-/m1/s1 |
| InChIKey | QHXFXLKZZIOIFU-OAHLLOKOSA-N |
| XLogP | 2.11 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|