About ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate
ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate (PubChem CID 134941137) has the molecular formula C22H23N3O5
and a molecular weight of 409.44 g/mol. Its IUPAC name is ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate.
Molecular Properties
| Compound Name | ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate |
| PubChem CID | 134941137 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate |
| SMILES | CCOC(=O)NN(C(=O)OCC)C(C#N)(Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O5/c1-3-29-20(27)24-25(21(28)30-4-2)22(16-23,15-17-11-7-5-8-12-17)19(26)18-13-9-6-10-14-18/h5-14H,3-4,15H2,1-2H3,(H,24,27) |
| InChIKey | PACHLEMIKKPMBK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate?
The IUPAC name of ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate (CID 134941137) is ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate.
What is the SMILES notation for ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate?
The canonical SMILES for ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate is CCOC(=O)NN(C(=O)OCC)C(C#N)(Cc1ccccc1)C(=O)c1ccccc1.
What is the InChIKey of ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate?
The InChIKey is PACHLEMIKKPMBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O5/c1-3-29-20(27)24-25(21(28)30-4-2)22(16-23,15-17-11-7-5-8-12-17)19(26)18-13-9-6-10-14-18/h5-14H,3-4,15H2,1-2H3,(H,24,27).
What are the key properties of ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate?
ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate has a molecular weight of 409.44 g/mol, XLogP of 3.49, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate is sourced from PubChem (CID 134941137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).