C22H23N3O5 — CID 134941137
ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate (PubChem CID 134941137) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate.
| Compound Name | ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 134941137 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | ethyl N-(2-cyano-1-oxo-1,3-diphenylpropan-2-yl)-N-(ethoxycarbonylamino)carbamate |
| SMILES | CCOC(=O)NN(C(=O)OCC)C(C#N)(Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O5/c1-3-29-20(27)24-25(21(28)30-4-2)22(16-23,15-17-11-7-5-8-12-17)19(26)18-13-9-6-10-14-18/h5-14H,3-4,15H2,1-2H3,(H,24,27) |
| InChIKey | PACHLEMIKKPMBK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|