C28H28N2O7 — CID 132596281
ethyl 2-methyl-3-oxo-3-phenyl-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate (PubChem CID 132596281) has the molecular formula C28H28N2O7 and a molecular weight of 504.54 g/mol. Its IUPAC name is ethyl 2-methyl-3-oxo-3-phenyl-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate.
| Compound Name | ethyl 2-methyl-3-oxo-3-phenyl-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate |
|---|---|
| PubChem CID | 132596281 |
| Molecular Formula | C28H28N2O7 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | ethyl 2-methyl-3-oxo-3-phenyl-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate |
| SMILES | CCOC(=O)C(C)(C(=O)c1ccccc1)N(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H28N2O7/c1-3-35-25(32)28(2,24(31)23-17-11-6-12-18-23)30(27(34)37-20-22-15-9-5-10-16-22)29-26(33)36-19-21-13-7-4-8-14-21/h4-18H,3,19-20H2,1-2H3,(H,29,33) |
| InChIKey | IZLMZIVFTHZMSI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|