C24H34N2O5 — CID 66764391
benzyl N-[(3,5-dimethylbenzoyl)-(1-methoxy-2-methylpropan-2-yl)amino]carbamate;methoxymethane (PubChem CID 66764391) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is benzyl N-[(3,5-dimethylbenzoyl)-(1-methoxy-2-methylpropan-2-yl)amino]carbamate;methoxymethane.
| Compound Name | benzyl N-[(3,5-dimethylbenzoyl)-(1-methoxy-2-methylpropan-2-yl)amino]carbamate;methoxymethane |
|---|---|
| PubChem CID | 66764391 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | benzyl N-[(3,5-dimethylbenzoyl)-(1-methoxy-2-methylpropan-2-yl)amino]carbamate;methoxymethane |
| SMILES | COC.COCC(C)(C)N(NC(=O)OCc1ccccc1)C(=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C22H28N2O4.C2H6O/c1-16-11-17(2)13-19(12-16)20(25)24(22(3,4)15-27-5)23-21(26)28-14-18-9-7-6-8-10-18;1-3-2/h6-13H,14-15H2,1-5H3,(H,23,26);1-2H3 |
| InChIKey | GSGUTXREUPEOJG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|