C46H57ClN4O10 — CID 159790663
3,5-dimethylbenzoyl chloride;ethyl 2-[(3,5-dimethylbenzoyl)-(phenylmethoxycarbonylamino)amino]-2-methylpropanoate;ethyl 2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoate (PubChem CID 159790663) has the molecular formula C46H57ClN4O10 and a molecular weight of 861.43 g/mol. Its IUPAC name is 3,5-dimethylbenzoyl chloride;ethyl 2-[(3,5-dimethylbenzoyl)-(phenylmethoxycarbonylamino)amino]-2-methylpropanoate;ethyl 2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoate.
| Compound Name | 3,5-dimethylbenzoyl chloride;ethyl 2-[(3,5-dimethylbenzoyl)-(phenylmethoxycarbonylamino)amino]-2-methylpropanoate;ethyl 2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoate |
|---|---|
| PubChem CID | 159790663 |
| Molecular Formula | C46H57ClN4O10 |
| Molecular Weight | 861.43 g/mol |
| Exact Mass | 860.38 |
| IUPAC Name | 3,5-dimethylbenzoyl chloride;ethyl 2-[(3,5-dimethylbenzoyl)-(phenylmethoxycarbonylamino)amino]-2-methylpropanoate;ethyl 2-methyl-2-(2-phenylmethoxycarbonylhydrazinyl)propanoate |
| SMILES | CCOC(=O)C(C)(C)N(NC(=O)OCc1ccccc1)C(=O)c1cc(C)cc(C)c1.CCOC(=O)C(C)(C)NNC(=O)OCc1ccccc1.Cc1cc(C)cc(C(=O)Cl)c1 |
| InChI | InChI=1S/C23H28N2O5.C14H20N2O4.C9H9ClO/c1-6-29-21(27)23(4,5)25(20(26)19-13-16(2)12-17(3)14-19)24-22(28)30-15-18-10-8-7-9-11-18;1-4-19-12(17)14(2,3)16-15-13(18)20-10-11-8-6-5-7-9-11;1-6-3-7(2)5-8(4-6)9(10)11/h7-14H,6,15H2,1-5H3,(H,24,28);5-9,16H,4,10H2,1-3H3,(H,15,18);3-5H,1-2H3 |
| InChIKey | NIMZOMPRDDSSJL-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 178.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.43 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|