C25H31ClN2O3 — CID 155082431
benzyl N-[[(4S)-7-(3-carbonochloridoyl-5-methylphenyl)-5,5-dimethylhept-1-en-4-yl]amino]carbamate (PubChem CID 155082431) has the molecular formula C25H31ClN2O3 and a molecular weight of 442.99 g/mol. Its IUPAC name is benzyl N-[[(4S)-7-(3-carbonochloridoyl-5-methylphenyl)-5,5-dimethylhept-1-en-4-yl]amino]carbamate.
| Compound Name | benzyl N-[[(4S)-7-(3-carbonochloridoyl-5-methylphenyl)-5,5-dimethylhept-1-en-4-yl]amino]carbamate |
|---|---|
| PubChem CID | 155082431 |
| Molecular Formula | C25H31ClN2O3 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | benzyl N-[[(4S)-7-(3-carbonochloridoyl-5-methylphenyl)-5,5-dimethylhept-1-en-4-yl]amino]carbamate |
| SMILES | C=CC[C@H](NNC(=O)OCc1ccccc1)C(C)(C)CCc1cc(C)cc(C(=O)Cl)c1 |
| InChI | InChI=1S/C25H31ClN2O3/c1-5-9-22(27-28-24(30)31-17-19-10-7-6-8-11-19)25(3,4)13-12-20-14-18(2)15-21(16-20)23(26)29/h5-8,10-11,14-16,22,27H,1,9,12-13,17H2,2-4H3,(H,28,30)/t22-/m0/s1 |
| InChIKey | WCELQVQPWULMII-QFIPXVFZSA-N |
| XLogP | 5.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|