C44H54N4O9 — CID 158082411
benzyl N-[(3,5-dimethylbenzoyl)-(1-hydroxy-2-methylpropan-2-yl)amino]carbamate;ethyl 2-[(3,5-dimethylbenzoyl)-(phenylmethoxycarbonylamino)amino]-2-methylpropanoate (PubChem CID 158082411) has the molecular formula C44H54N4O9 and a molecular weight of 782.94 g/mol. Its IUPAC name is benzyl N-[(3,5-dimethylbenzoyl)-(1-hydroxy-2-methylpropan-2-yl)amino]carbamate;ethyl 2-[(3,5-dimethylbenzoyl)-(phenylmethoxycarbonylamino)amino]-2-methylpropanoate.
| Compound Name | benzyl N-[(3,5-dimethylbenzoyl)-(1-hydroxy-2-methylpropan-2-yl)amino]carbamate;ethyl 2-[(3,5-dimethylbenzoyl)-(phenylmethoxycarbonylamino)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 158082411 |
| Molecular Formula | C44H54N4O9 |
| Molecular Weight | 782.94 g/mol |
| Exact Mass | 782.39 |
| IUPAC Name | benzyl N-[(3,5-dimethylbenzoyl)-(1-hydroxy-2-methylpropan-2-yl)amino]carbamate;ethyl 2-[(3,5-dimethylbenzoyl)-(phenylmethoxycarbonylamino)amino]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)N(NC(=O)OCc1ccccc1)C(=O)c1cc(C)cc(C)c1.Cc1cc(C)cc(C(=O)N(NC(=O)OCc2ccccc2)C(C)(C)CO)c1 |
| InChI | InChI=1S/C23H28N2O5.C21H26N2O4/c1-6-29-21(27)23(4,5)25(20(26)19-13-16(2)12-17(3)14-19)24-22(28)30-15-18-10-8-7-9-11-18;1-15-10-16(2)12-18(11-15)19(25)23(21(3,4)14-24)22-20(26)27-13-17-8-6-5-7-9-17/h7-14H,6,15H2,1-5H3,(H,24,28);5-12,24H,13-14H2,1-4H3,(H,22,26) |
| InChIKey | FNCOTXBUIWOXDJ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 163.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.94 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|