C22H26N2O7S — CID 16726971
methyl 2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-(4-methoxyphenyl)-2-phenylsulfanylacetate (PubChem CID 16726971) has the molecular formula C22H26N2O7S and a molecular weight of 462.52 g/mol. Its IUPAC name is methyl 2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-(4-methoxyphenyl)-2-phenylsulfanylacetate.
| Compound Name | methyl 2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-(4-methoxyphenyl)-2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 16726971 |
| Molecular Formula | C22H26N2O7S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | methyl 2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-(4-methoxyphenyl)-2-phenylsulfanylacetate |
| SMILES | CCOC(=O)NN(C(=O)OCC)C(Sc1ccccc1)(C(=O)OC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H26N2O7S/c1-5-30-20(26)23-24(21(27)31-6-2)22(19(25)29-4,32-18-10-8-7-9-11-18)16-12-14-17(28-3)15-13-16/h7-15H,5-6H2,1-4H3,(H,23,26) |
| InChIKey | RGUQKRAJAHNGNZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|