C19H18O3S — CID 23248186
methyl 2-(4-methoxyphenyl)-2-phenylsulfanylpenta-3,4-dienoate (PubChem CID 23248186) has the molecular formula C19H18O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is methyl 2-(4-methoxyphenyl)-2-phenylsulfanylpenta-3,4-dienoate.
| Compound Name | methyl 2-(4-methoxyphenyl)-2-phenylsulfanylpenta-3,4-dienoate |
|---|---|
| PubChem CID | 23248186 |
| Molecular Formula | C19H18O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | methyl 2-(4-methoxyphenyl)-2-phenylsulfanylpenta-3,4-dienoate |
| SMILES | C=C=CC(Sc1ccccc1)(C(=O)OC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H18O3S/c1-4-14-19(18(20)22-3,23-17-8-6-5-7-9-17)15-10-12-16(21-2)13-11-15/h5-14H,1H2,2-3H3 |
| InChIKey | OVGWHYWWLBMNQU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |