C28H24Cl2N2O — CID 143237963
[4-(2-chloro-4-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]-naphthalen-1-ylmethanone (PubChem CID 143237963) has the molecular formula C28H24Cl2N2O and a molecular weight of 475.42 g/mol. Its IUPAC name is [4-(2-chloro-4-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]-naphthalen-1-ylmethanone.
| Compound Name | [4-(2-chloro-4-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 143237963 |
| Molecular Formula | C28H24Cl2N2O |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | [4-(2-chloro-4-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]-naphthalen-1-ylmethanone |
| SMILES | Cc1ccc(N2CCN(C(=O)c3cccc4ccccc34)CC2c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C28H24Cl2N2O/c1-19-9-14-26(25(30)17-19)32-16-15-31(18-27(32)21-10-12-22(29)13-11-21)28(33)24-8-4-6-20-5-2-3-7-23(20)24/h2-14,17,27H,15-16,18H2,1H3 |
| InChIKey | BBMLFKULCTXXGN-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |