C19H20Cl2N2O — CID 143237547
1-[4-(2-chloro-4-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]ethanone (PubChem CID 143237547) has the molecular formula C19H20Cl2N2O and a molecular weight of 363.29 g/mol. Its IUPAC name is 1-[4-(2-chloro-4-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(2-chloro-4-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 143237547 |
| Molecular Formula | C19H20Cl2N2O |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-[4-(2-chloro-4-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(C)cc2Cl)C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H20Cl2N2O/c1-13-3-8-18(17(21)11-13)23-10-9-22(14(2)24)12-19(23)15-4-6-16(20)7-5-15/h3-8,11,19H,9-10,12H2,1-2H3 |
| InChIKey | RUOJCZGFRAJYBE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |