C21H22Cl3N3O — CID 163978720
2-amino-1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-3-methylbut-3-en-1-one (PubChem CID 163978720) has the molecular formula C21H22Cl3N3O and a molecular weight of 438.79 g/mol. Its IUPAC name is 2-amino-1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-3-methylbut-3-en-1-one.
| Compound Name | 2-amino-1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-3-methylbut-3-en-1-one |
|---|---|
| PubChem CID | 163978720 |
| Molecular Formula | C21H22Cl3N3O |
| Molecular Weight | 438.79 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 2-amino-1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-3-methylbut-3-en-1-one |
| SMILES | C=C(C)C(N)C(=O)N1CCN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C21H22Cl3N3O/c1-13(2)20(25)21(28)26-9-10-27(18-8-7-16(23)11-17(18)24)19(12-26)14-3-5-15(22)6-4-14/h3-8,11,19-20H,1,9-10,12,25H2,2H3 |
| InChIKey | SWMFTUWOAACFGD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.79 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|