C21H17FN4O2S2 — CID 143238515
2-[3-(3-fluorophenyl)-5-(3-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetohydrazide (PubChem CID 143238515) has the molecular formula C21H17FN4O2S2 and a molecular weight of 440.53 g/mol. Its IUPAC name is 2-[3-(3-fluorophenyl)-5-(3-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetohydrazide.
| Compound Name | 2-[3-(3-fluorophenyl)-5-(3-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetohydrazide |
|---|---|
| PubChem CID | 143238515 |
| Molecular Formula | C21H17FN4O2S2 |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-[3-(3-fluorophenyl)-5-(3-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylacetohydrazide |
| SMILES | Cc1cccc(-c2csc3nc(SCC(=O)NN)n(-c4cccc(F)c4)c(=O)c23)c1 |
| InChI | InChI=1S/C21H17FN4O2S2/c1-12-4-2-5-13(8-12)16-10-29-19-18(16)20(28)26(15-7-3-6-14(22)9-15)21(24-19)30-11-17(27)25-23/h2-10H,11,23H2,1H3,(H,25,27) |
| InChIKey | MQDLNNDYYJBHBR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|