C17H28BrNO3 — CID 143238625
(1S,4R,5S)-4-(2-bromoethyl)-1,5,7-trimethyl-6-oxa-2-azabicyclo[3.2.0]heptan-3-one;[(1S)-cyclohex-2-en-1-yl]methanol (PubChem CID 143238625) has the molecular formula C17H28BrNO3 and a molecular weight of 374.32 g/mol. Its IUPAC name is (1S,4R,5S)-4-(2-bromoethyl)-1,5,7-trimethyl-6-oxa-2-azabicyclo[3.2.0]heptan-3-one;[(1S)-cyclohex-2-en-1-yl]methanol.
| Compound Name | (1S,4R,5S)-4-(2-bromoethyl)-1,5,7-trimethyl-6-oxa-2-azabicyclo[3.2.0]heptan-3-one;[(1S)-cyclohex-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 143238625 |
| Molecular Formula | C17H28BrNO3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (1S,4R,5S)-4-(2-bromoethyl)-1,5,7-trimethyl-6-oxa-2-azabicyclo[3.2.0]heptan-3-one;[(1S)-cyclohex-2-en-1-yl]methanol |
| SMILES | CC1O[C@@]2(C)[C@@H](CCBr)C(=O)N[C@@]12C.OC[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C10H16BrNO2.C7H12O/c1-6-9(2)10(3,14-6)7(4-5-11)8(13)12-9;8-6-7-4-2-1-3-5-7/h6-7H,4-5H2,1-3H3,(H,12,13);2,4,7-8H,1,3,5-6H2/t6?,7-,9-,10-;7-/m01/s1 |
| InChIKey | DFPVLZPKBDAVLZ-YYTPIWIESA-N |
| XLogP | 2.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|