C14H21NO4 — CID 143895277
3-(cyclohex-2-en-1-ylmethyl)-6-(2-hydroxyethyl)-3-methylmorpholine-2,5-dione (PubChem CID 143895277) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 3-(cyclohex-2-en-1-ylmethyl)-6-(2-hydroxyethyl)-3-methylmorpholine-2,5-dione.
| Compound Name | 3-(cyclohex-2-en-1-ylmethyl)-6-(2-hydroxyethyl)-3-methylmorpholine-2,5-dione |
|---|---|
| PubChem CID | 143895277 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-(cyclohex-2-en-1-ylmethyl)-6-(2-hydroxyethyl)-3-methylmorpholine-2,5-dione |
| SMILES | CC1(CC2C=CCCC2)NC(=O)C(CCO)OC1=O |
| InChI | InChI=1S/C14H21NO4/c1-14(9-10-5-3-2-4-6-10)13(18)19-11(7-8-16)12(17)15-14/h3,5,10-11,16H,2,4,6-9H2,1H3,(H,15,17) |
| InChIKey | SAQXXXOHSVZXOG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|