C14H21NO5 — CID 70952269
3-[cyclohex-2-en-1-yl(hydroxy)methyl]-6-(2-hydroxyethyl)-3-methylmorpholine-2,5-dione (PubChem CID 70952269) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 3-[cyclohex-2-en-1-yl(hydroxy)methyl]-6-(2-hydroxyethyl)-3-methylmorpholine-2,5-dione.
| Compound Name | 3-[cyclohex-2-en-1-yl(hydroxy)methyl]-6-(2-hydroxyethyl)-3-methylmorpholine-2,5-dione |
|---|---|
| PubChem CID | 70952269 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 3-[cyclohex-2-en-1-yl(hydroxy)methyl]-6-(2-hydroxyethyl)-3-methylmorpholine-2,5-dione |
| SMILES | CC1(C(O)C2C=CCCC2)NC(=O)C(CCO)OC1=O |
| InChI | InChI=1S/C14H21NO5/c1-14(11(17)9-5-3-2-4-6-9)13(19)20-10(7-8-16)12(18)15-14/h3,5,9-11,16-17H,2,4,6-8H2,1H3,(H,15,18) |
| InChIKey | MPKATTOCJRKZOF-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|