C16H29NO4 — CID 143558559
(2S,5S)-5-[[(1R)-cyclohex-2-en-1-yl]methyl]-5-ethyl-2-(2-hydroxyethyl)morpholin-3-one;methanol (PubChem CID 143558559) has the molecular formula C16H29NO4 and a molecular weight of 299.41 g/mol. Its IUPAC name is (2S,5S)-5-[[(1R)-cyclohex-2-en-1-yl]methyl]-5-ethyl-2-(2-hydroxyethyl)morpholin-3-one;methanol.
| Compound Name | (2S,5S)-5-[[(1R)-cyclohex-2-en-1-yl]methyl]-5-ethyl-2-(2-hydroxyethyl)morpholin-3-one;methanol |
|---|---|
| PubChem CID | 143558559 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | (2S,5S)-5-[[(1R)-cyclohex-2-en-1-yl]methyl]-5-ethyl-2-(2-hydroxyethyl)morpholin-3-one;methanol |
| SMILES | CC[C@]1(C[C@@H]2C=CCCC2)CO[C@@H](CCO)C(=O)N1.CO |
| InChI | InChI=1S/C15H25NO3.CH4O/c1-2-15(10-12-6-4-3-5-7-12)11-19-13(8-9-17)14(18)16-15;1-2/h4,6,12-13,17H,2-3,5,7-11H2,1H3,(H,16,18);2H,1H3/t12-,13+,15+;/m1./s1 |
| InChIKey | DWLYOEOPLFKABQ-OQSTVXQLSA-N |
| XLogP | 1.39 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|