C15H25NO4 — CID 145482378
(2S,5R)-5-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-ethyl-2-(2-hydroxyethyl)morpholin-3-one (PubChem CID 145482378) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is (2S,5R)-5-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-ethyl-2-(2-hydroxyethyl)morpholin-3-one.
| Compound Name | (2S,5R)-5-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-ethyl-2-(2-hydroxyethyl)morpholin-3-one |
|---|---|
| PubChem CID | 145482378 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | (2S,5R)-5-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-ethyl-2-(2-hydroxyethyl)morpholin-3-one |
| SMILES | CC[C@]1([C@@H](O)[C@@H]2C=CCCC2)CO[C@@H](CCO)C(=O)N1 |
| InChI | InChI=1S/C15H25NO4/c1-2-15(13(18)11-6-4-3-5-7-11)10-20-12(8-9-17)14(19)16-15/h4,6,11-13,17-18H,2-3,5,7-10H2,1H3,(H,16,19)/t11-,12+,13+,15-/m1/s1 |
| InChIKey | CKYHCZSTZSXHLQ-UKTARXLSSA-N |
| XLogP | 0.75 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|