C19H31NO5 — CID 11962082
(2R,3S)-2-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-hexyl-3-hydroxy-3-methyl-5-oxopyrrolidine-2-carboxylic acid (PubChem CID 11962082) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is (2R,3S)-2-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-hexyl-3-hydroxy-3-methyl-5-oxopyrrolidine-2-carboxylic acid.
| Compound Name | (2R,3S)-2-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-hexyl-3-hydroxy-3-methyl-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 11962082 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | (2R,3S)-2-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-hexyl-3-hydroxy-3-methyl-5-oxopyrrolidine-2-carboxylic acid |
| SMILES | CCCCCCC1C(=O)N[C@](C(=O)O)(C(O)[C@@H]2C=CCCC2)[C@@]1(C)O |
| InChI | InChI=1S/C19H31NO5/c1-3-4-5-9-12-14-16(22)20-19(17(23)24,18(14,2)25)15(21)13-10-7-6-8-11-13/h7,10,13-15,21,25H,3-6,8-9,11-12H2,1-2H3,(H,20,22)(H,23,24)/t13-,14?,15?,18+,19+/m1/s1 |
| InChIKey | ADDRECXFKLYOGC-BPWHFZPZSA-N |
| XLogP | 1.99 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|