C21H31NO5 — CID 87194523
[cyclohex-2-en-1-yl-[(1R,4R,5S)-4-hexyl-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-1-yl]methyl] acetate (PubChem CID 87194523) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is [cyclohex-2-en-1-yl-[(1R,4R,5S)-4-hexyl-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-1-yl]methyl] acetate.
| Compound Name | [cyclohex-2-en-1-yl-[(1R,4R,5S)-4-hexyl-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-1-yl]methyl] acetate |
|---|---|
| PubChem CID | 87194523 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | [cyclohex-2-en-1-yl-[(1R,4R,5S)-4-hexyl-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-1-yl]methyl] acetate |
| SMILES | CCCCCC[C@H]1C(=O)N[C@@]2(C(OC(C)=O)C3C=CCCC3)C(=O)O[C@@]12C |
| InChI | InChI=1S/C21H31NO5/c1-4-5-6-10-13-16-18(24)22-21(19(25)27-20(16,21)3)17(26-14(2)23)15-11-8-7-9-12-15/h8,11,15-17H,4-7,9-10,12-13H2,1-3H3,(H,22,24)/t15?,16-,17?,20-,21-/m0/s1 |
| InChIKey | YIAFSKHFHKZAGZ-ZGAJACCXSA-N |
| XLogP | 3.05 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|