C26H43NO4 — CID 58729189
(3R,4S,5R)-5-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-(2-cyclohexylacetyl)-3-hexyl-4-hydroxy-4-methylpyrrolidin-2-one (PubChem CID 58729189) has the molecular formula C26H43NO4 and a molecular weight of 433.63 g/mol. Its IUPAC name is (3R,4S,5R)-5-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-(2-cyclohexylacetyl)-3-hexyl-4-hydroxy-4-methylpyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-5-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-(2-cyclohexylacetyl)-3-hexyl-4-hydroxy-4-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 58729189 |
| Molecular Formula | C26H43NO4 |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 433.32 |
| IUPAC Name | (3R,4S,5R)-5-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-(2-cyclohexylacetyl)-3-hexyl-4-hydroxy-4-methylpyrrolidin-2-one |
| SMILES | CCCCCC[C@H]1C(=O)N[C@](C(=O)CC2CCCCC2)([C@@H](O)[C@@H]2C=CCCC2)[C@@]1(C)O |
| InChI | InChI=1S/C26H43NO4/c1-3-4-5-12-17-21-24(30)27-26(25(21,2)31,23(29)20-15-10-7-11-16-20)22(28)18-19-13-8-6-9-14-19/h10,15,19-21,23,29,31H,3-9,11-14,16-18H2,1-2H3,(H,27,30)/t20-,21+,23+,25+,26-/m1/s1 |
| InChIKey | LBJZNKCLSTUAON-YHIMMSLVSA-N |
| XLogP | 4.45 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|