C25H41NO4S — CID 58112212
S-cyclohexyl (2R,3S,4R)-2-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-hexyl-3-hydroxy-3-methyl-5-oxopyrrolidine-2-carbothioate (PubChem CID 58112212) has the molecular formula C25H41NO4S and a molecular weight of 451.67 g/mol. Its IUPAC name is S-cyclohexyl (2R,3S,4R)-2-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-hexyl-3-hydroxy-3-methyl-5-oxopyrrolidine-2-carbothioate.
| Compound Name | S-cyclohexyl (2R,3S,4R)-2-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-hexyl-3-hydroxy-3-methyl-5-oxopyrrolidine-2-carbothioate |
|---|---|
| PubChem CID | 58112212 |
| Molecular Formula | C25H41NO4S |
| Molecular Weight | 451.67 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | S-cyclohexyl (2R,3S,4R)-2-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-hexyl-3-hydroxy-3-methyl-5-oxopyrrolidine-2-carbothioate |
| SMILES | CCCCCC[C@H]1C(=O)N[C@](C(=O)SC2CCCCC2)([C@@H](O)[C@@H]2C=CCCC2)[C@@]1(C)O |
| InChI | InChI=1S/C25H41NO4S/c1-3-4-5-12-17-20-22(28)26-25(24(20,2)30,21(27)18-13-8-6-9-14-18)23(29)31-19-15-10-7-11-16-19/h8,13,18-21,27,30H,3-7,9-12,14-17H2,1-2H3,(H,26,28)/t18-,20+,21+,24+,25+/m1/s1 |
| InChIKey | QEOQCQQSHXAFLY-VAQZVYIFSA-N |
| XLogP | 4.50 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.67 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|