C16H26ClNO3 — CID 163557698
(3S,4R,5S)-3-(2-chloroethyl)-5-[[(1R)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-methoxy-4,5-dimethylpyrrolidin-2-one (PubChem CID 163557698) has the molecular formula C16H26ClNO3 and a molecular weight of 315.84 g/mol. Its IUPAC name is (3S,4R,5S)-3-(2-chloroethyl)-5-[[(1R)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-methoxy-4,5-dimethylpyrrolidin-2-one.
| Compound Name | (3S,4R,5S)-3-(2-chloroethyl)-5-[[(1R)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-methoxy-4,5-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 163557698 |
| Molecular Formula | C16H26ClNO3 |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (3S,4R,5S)-3-(2-chloroethyl)-5-[[(1R)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-methoxy-4,5-dimethylpyrrolidin-2-one |
| SMILES | CO[C@]1(C)[C@H](CCCl)C(=O)N[C@@]1(C)C(O)[C@H]1C=CCCC1 |
| InChI | InChI=1S/C16H26ClNO3/c1-15(13(19)11-7-5-4-6-8-11)16(2,21-3)12(9-10-17)14(20)18-15/h5,7,11-13,19H,4,6,8-10H2,1-3H3,(H,18,20)/t11-,12+,13?,15-,16+/m0/s1 |
| InChIKey | FONSIPBVHHWJSA-RRYDCEEVSA-N |
| XLogP | 2.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|