C23H28ClNO5 — CID 161300326
(4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-[(4-methoxyphenyl)methyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 161300326) has the molecular formula C23H28ClNO5 and a molecular weight of 433.93 g/mol. Its IUPAC name is (4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-[(4-methoxyphenyl)methyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-[(4-methoxyphenyl)methyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 161300326 |
| Molecular Formula | C23H28ClNO5 |
| Molecular Weight | 433.93 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-[(4-methoxyphenyl)methyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | COc1ccc(CN2C(=O)[C@H](CCCl)[C@]3(C)OC(=O)C23[C@@H](O)[C@@H]2C=CCCC2)cc1 |
| InChI | InChI=1S/C23H28ClNO5/c1-22-18(12-13-24)20(27)25(14-15-8-10-17(29-2)11-9-15)23(22,21(28)30-22)19(26)16-6-4-3-5-7-16/h4,6,8-11,16,18-19,26H,3,5,7,12-14H2,1-2H3/t16-,18+,19+,22+,23?/m1/s1 |
| InChIKey | AFQCWZJJVNAVML-CROZSXMDSA-N |
| XLogP | 3.05 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.93 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|