C28H35NO5 — CID 16679990
(1R,4R,5S)-4-hexyl-2-[(4-methoxyphenyl)methyl]-5-methyl-1-(phenylmethoxymethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 16679990) has the molecular formula C28H35NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is (1R,4R,5S)-4-hexyl-2-[(4-methoxyphenyl)methyl]-5-methyl-1-(phenylmethoxymethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (1R,4R,5S)-4-hexyl-2-[(4-methoxyphenyl)methyl]-5-methyl-1-(phenylmethoxymethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 16679990 |
| Molecular Formula | C28H35NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | (1R,4R,5S)-4-hexyl-2-[(4-methoxyphenyl)methyl]-5-methyl-1-(phenylmethoxymethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | CCCCCC[C@H]1C(=O)N(Cc2ccc(OC)cc2)[C@@]2(COCc3ccccc3)C(=O)O[C@@]12C |
| InChI | InChI=1S/C28H35NO5/c1-4-5-6-10-13-24-25(30)29(18-21-14-16-23(32-3)17-15-21)28(26(31)34-27(24,28)2)20-33-19-22-11-8-7-9-12-22/h7-9,11-12,14-17,24H,4-6,10,13,18-20H2,1-3H3/t24-,27-,28-/m0/s1 |
| InChIKey | KAAUTBVCGOVRDQ-WIRXVTQYSA-N |
| XLogP | 4.90 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|