C17H20ClNO5 — CID 87427142
(4S,5R)-4-(2-chloroethyl)-1-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 87427142) has the molecular formula C17H20ClNO5 and a molecular weight of 353.80 g/mol. Its IUPAC name is (4S,5R)-4-(2-chloroethyl)-1-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (4S,5R)-4-(2-chloroethyl)-1-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 87427142 |
| Molecular Formula | C17H20ClNO5 |
| Molecular Weight | 353.80 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | (4S,5R)-4-(2-chloroethyl)-1-(hydroxymethyl)-2-[(4-methoxyphenyl)methyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | COc1ccc(CN2C(=O)[C@@H](CCCl)[C@@]3(C)OC(=O)C23CO)cc1 |
| InChI | InChI=1S/C17H20ClNO5/c1-16-13(7-8-18)14(21)19(17(16,10-20)15(22)24-16)9-11-3-5-12(23-2)6-4-11/h3-6,13,20H,7-10H2,1-2H3/t13-,16-,17?/m1/s1 |
| InChIKey | HSFDXGVSPJYOHW-ZIAVVELASA-N |
| XLogP | 1.33 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.80 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|