C34H43NO7 — CID 58773484
tert-butyl (2R,3aS,6R,6aS)-6-[(R)-[(1R)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-[(4-methoxyphenyl)methyl]-6a-methyl-4-oxo-2-phenylmethoxy-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6-carboxylate (PubChem CID 58773484) has the molecular formula C34H43NO7 and a molecular weight of 577.72 g/mol. Its IUPAC name is tert-butyl (2R,3aS,6R,6aS)-6-[(R)-[(1R)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-[(4-methoxyphenyl)methyl]-6a-methyl-4-oxo-2-phenylmethoxy-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6-carboxylate.
| Compound Name | tert-butyl (2R,3aS,6R,6aS)-6-[(R)-[(1R)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-[(4-methoxyphenyl)methyl]-6a-methyl-4-oxo-2-phenylmethoxy-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6-carboxylate |
|---|---|
| PubChem CID | 58773484 |
| Molecular Formula | C34H43NO7 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | tert-butyl (2R,3aS,6R,6aS)-6-[(R)-[(1R)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-[(4-methoxyphenyl)methyl]-6a-methyl-4-oxo-2-phenylmethoxy-3,3a-dihydro-2H-furo[2,3-c]pyrrole-6-carboxylate |
| SMILES | COc1ccc(CN2C(=O)[C@H]3C[C@H](OCc4ccccc4)O[C@]3(C)[C@@]2(C(=O)OC(C)(C)C)[C@H](O)[C@H]2C=CCCC2)cc1 |
| InChI | InChI=1S/C34H43NO7/c1-32(2,3)42-31(38)34(29(36)25-14-10-7-11-15-25)33(4)27(20-28(41-33)40-22-24-12-8-6-9-13-24)30(37)35(34)21-23-16-18-26(39-5)19-17-23/h6,8-10,12-14,16-19,25,27-29,36H,7,11,15,20-22H2,1-5H3/t25-,27+,28+,29+,33-,34-/m0/s1 |
| InChIKey | HKOTWQMSEHSBCW-LEZJUWCESA-N |
| XLogP | 5.17 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|