C22H27NO5 — CID 91547963
(3aR,6S,6aS)-6-(cyclohexene-1-carbonyl)-6-(hydroxymethyl)-6a-methyl-2-phenylmethoxy-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrol-4-one (PubChem CID 91547963) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is (3aR,6S,6aS)-6-(cyclohexene-1-carbonyl)-6-(hydroxymethyl)-6a-methyl-2-phenylmethoxy-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrol-4-one.
| Compound Name | (3aR,6S,6aS)-6-(cyclohexene-1-carbonyl)-6-(hydroxymethyl)-6a-methyl-2-phenylmethoxy-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrol-4-one |
|---|---|
| PubChem CID | 91547963 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (3aR,6S,6aS)-6-(cyclohexene-1-carbonyl)-6-(hydroxymethyl)-6a-methyl-2-phenylmethoxy-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrol-4-one |
| SMILES | C[C@]12OC(OCc3ccccc3)C[C@H]1C(=O)N[C@]2(CO)C(=O)C1=CCCCC1 |
| InChI | InChI=1S/C22H27NO5/c1-21-17(12-18(28-21)27-13-15-8-4-2-5-9-15)20(26)23-22(21,14-24)19(25)16-10-6-3-7-11-16/h2,4-5,8-10,17-18,24H,3,6-7,11-14H2,1H3,(H,23,26)/t17-,18?,21-,22+/m0/s1 |
| InChIKey | QJFOVUXGENGFFY-ARNIEWOOSA-N |
| XLogP | 2.25 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |