C21H29NO5 — CID 70671324
(1S,2S,4S,6R,9S)-9-tert-butyl-1-(hydroxymethyl)-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one (PubChem CID 70671324) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is (1S,2S,4S,6R,9S)-9-tert-butyl-1-(hydroxymethyl)-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one.
| Compound Name | (1S,2S,4S,6R,9S)-9-tert-butyl-1-(hydroxymethyl)-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one |
|---|---|
| PubChem CID | 70671324 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | (1S,2S,4S,6R,9S)-9-tert-butyl-1-(hydroxymethyl)-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one |
| SMILES | CC(C)(C)[C@@H]1OC[C@]2(CO)N1C(=O)[C@@H]1C[C@@H](OCc3ccccc3)O[C@@]12C |
| InChI | InChI=1S/C21H29NO5/c1-19(2,3)18-22-17(24)15-10-16(25-11-14-8-6-5-7-9-14)27-20(15,4)21(22,12-23)13-26-18/h5-9,15-16,18,23H,10-13H2,1-4H3/t15-,16-,18-,20-,21-/m0/s1 |
| InChIKey | QMODSIOXQUDRNK-BWOMAWGNSA-N |
| XLogP | 2.30 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |