C17H26O3 — CID 101089037
(2S,3R,4R,6S)-6-tert-butyl-3-methyl-4-phenylmethoxyoxan-2-ol (PubChem CID 101089037) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (2S,3R,4R,6S)-6-tert-butyl-3-methyl-4-phenylmethoxyoxan-2-ol.
| Compound Name | (2S,3R,4R,6S)-6-tert-butyl-3-methyl-4-phenylmethoxyoxan-2-ol |
|---|---|
| PubChem CID | 101089037 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (2S,3R,4R,6S)-6-tert-butyl-3-methyl-4-phenylmethoxyoxan-2-ol |
| SMILES | C[C@H]1[C@@H](O)O[C@H](C(C)(C)C)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C17H26O3/c1-12-14(19-11-13-8-6-5-7-9-13)10-15(17(2,3)4)20-16(12)18/h5-9,12,14-16,18H,10-11H2,1-4H3/t12-,14-,15+,16+/m1/s1 |
| InChIKey | QOGCZOOWPRFBOL-OJLVUWQFSA-N |
| XLogP | 3.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |