C15H21NO3 — CID 143575963
(3S,6S)-3-(cyclohex-2-en-1-ylmethyl)-6-ethenyl-3-ethylmorpholine-2,5-dione (PubChem CID 143575963) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is (3S,6S)-3-(cyclohex-2-en-1-ylmethyl)-6-ethenyl-3-ethylmorpholine-2,5-dione.
| Compound Name | (3S,6S)-3-(cyclohex-2-en-1-ylmethyl)-6-ethenyl-3-ethylmorpholine-2,5-dione |
|---|---|
| PubChem CID | 143575963 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (3S,6S)-3-(cyclohex-2-en-1-ylmethyl)-6-ethenyl-3-ethylmorpholine-2,5-dione |
| SMILES | C=C[C@@H]1OC(=O)[C@](CC)(CC2C=CCCC2)NC1=O |
| InChI | InChI=1S/C15H21NO3/c1-3-12-13(17)16-15(4-2,14(18)19-12)10-11-8-6-5-7-9-11/h3,6,8,11-12H,1,4-5,7,9-10H2,2H3,(H,16,17)/t11?,12-,15-/m0/s1 |
| InChIKey | CNLBBCORQLMJQY-LBBQAWJBSA-N |
| XLogP | 2.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|