C22H24N5O3S+ — CID 143239067
[3-[4-(1,2-benzothiazol-3-yl)piperazine-1-carbonyl]-4-morpholin-4-ylphenyl]-oxoazanium (PubChem CID 143239067) has the molecular formula C22H24N5O3S+ and a molecular weight of 438.53 g/mol. Its IUPAC name is [3-[4-(1,2-benzothiazol-3-yl)piperazine-1-carbonyl]-4-morpholin-4-ylphenyl]-oxoazanium.
| Compound Name | [3-[4-(1,2-benzothiazol-3-yl)piperazine-1-carbonyl]-4-morpholin-4-ylphenyl]-oxoazanium |
|---|---|
| PubChem CID | 143239067 |
| Molecular Formula | C22H24N5O3S+ |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | [3-[4-(1,2-benzothiazol-3-yl)piperazine-1-carbonyl]-4-morpholin-4-ylphenyl]-oxoazanium |
| SMILES | O=[NH+]c1ccc(N2CCOCC2)c(C(=O)N2CCN(c3nsc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C22H23N5O3S/c28-22(18-15-16(23-29)5-6-19(18)25-11-13-30-14-12-25)27-9-7-26(8-10-27)21-17-3-1-2-4-20(17)31-24-21/h1-6,15H,7-14H2/p+1 |
| InChIKey | JUWMKEHXYCJFLK-UHFFFAOYSA-O |
| XLogP | 1.57 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|